You have no items in your shopping cart.
Cart summary
(S)-CPP sodium
Catalog Number: orb2695452
| Catalog Number | orb2695452 |
|---|---|
| Category | Small Molecules |
| Description | (S)-CPP sodium serves as an inhibitor of the branched-chain α-keto acid dehydrogenase complex (BCKDC) kinase, commonly referred to as BDK or keto acid dehydrogenase kinase. As a negative regulator of BCKDC activity, (S)-CPP (IC50 of 6.3 μM) inhibits BDK, which activates the complex, leading to a significant reduction in the levels of leucine/isoleucine and valine in the plasma of wild-type mice. |
| CAS Number | 194979-70-9 |
| MW | 206.60 |
| SMILES | [O-]C([C@@H](Cl)CC1=CC=CC=C1)=O.[Na+] |
| Formula | C9H8ClNaO2 |
| Storage | -20°C |
| Note | For research use only |
| Expiration Date | 12 months from date of receipt. |
