You have no items in your shopping cart.
You have no items in your shopping cart.
Catalog Number | orb2695126 |
---|---|
Category | Small Molecules |
Description | (rac./meso)-Astaxanthin (AstaREAL; AstaXin) is a carotenoid pigment primarily found in marine animals such as shrimp and salmon. It serves as an effective fat-soluble antioxidant. |
MW | 596.84 |
CAS Number | 7542-45-2 |
Formula | C40H52O4 |
SMILES | C(=C/C(=C/C=C/C(=C/C=C/C=C(/C=C/C=C(/C=C/C=1C(C)(C)CC(O)C(=O)C1C)\C)\C)/C)/C)\C=2C(C)(C)CC(O)C(=O)C2C |
Storage | -20°C |
Note | For research use only |