You have no items in your shopping cart.
Cart summary
rac-Hesperetin-13C-d3
Catalog Number: orb2299900
| Catalog Number | orb2299900 |
|---|---|
| Category | Small Molecules |
| Description | rac-Hesperetin-13C-d3 the 13C and deuterated compound of rac-Hesperetin. rac-Hesperetin has a CAS number of 69097-99-0. (Rac)-Hesperetin is the racemate form of of Hesperetin. Hesperetin is a natural flavanone compound, and it exhibits potent inhibitory effects against human UGT activity, making it a broad-spectrum inhibitor. Furthermore, Hesperetin induces apoptosis through the activation of p38 MAPK. |
| Purity | 98.00% |
| MW | 306.29 |
| SMILES | C1(O)C(O[13C]([2H])([2H])[2H])=CC=C(C2OC3C(C(=O)C2)=C(O)C=C(O)C=3)C=1 |
| Formula | 13CC15D3H11O6 |
| Biological Activity | rac-Hesperetin-13C-d3 the 13C and deuterated compound of rac-Hesperetin. rac-Hesperetin has a CAS number of 69097-99-0. (Rac)-Hesperetin is the racemate form of of Hesperetin. Hesperetin is a natural flavanone compound, and it exhibits potent inhibitory effects against human UGT activity, making it a broad-spectrum inhibitor. Furthermore, Hesperetin induces apoptosis through the activation of p38 MAPK. |
| Storage | -20°C |
| Note | For research use only |
| Expiration Date | 12 months from date of receipt. |
