You have no items in your shopping cart.
Cart summary
Prodigiosin hydrochloride
Catalog Number: orb1690457
| Catalog Number | orb1690457 |
|---|---|
| Category | Small Molecules |
| Description | Prodigiosin hydrochloride |
| CAS Number | 56144-17-3 |
| Purity | 98% |
| MW | 359.9 |
| SMILES | Cl.CCCCCC1=C\C(=C/c2[nH]c(cc2OC)-c2ccc[nH]2)N=C1C |
| Formula | C20H26ClN3O |
| Biological Activity | Prodigiosin hydrochloride, a red pigment, is a bioactive secondary metabolite produced by bacteria. It exhibits potent proapoptotic activity and functions as an inhibitor of the Wnt/β-catenin pathway. Additionally, this compound possesses antibacterial, antifungal, antiprotozoal, antimalarial, immunosuppressive, and anticancer properties. |
| Storage | -20°C |
| Note | For research use only |
| Expiration Date | 12 months from date of receipt. |
