You have no items in your shopping cart.
You have no items in your shopping cart.
Catalog Number | orb1305505 |
---|---|
Category | Small Molecules |
Description | PNU-282987 |
Purity | 99.00% |
MW | 301.21 |
Biological Activity | PNU-282987 is a selective α7 nicotinic acetylcholine receptor(α7 nAChR) agonist with Ki of 26 nM; no affinity for α1β1γδ and α3β4 nAChRs (IC50 ≥ 60 μM). |
CAS Number | [123464-89-1] |
Formula | C14H18Cl2N2O |
SMILES | Cl.C1CN2CCC1[C@H](C2)NC(=O)c1ccc(cc1)Cl |
Storage | -20°C |
Note | For research use only |
> 98% (HPLC) | |
123464-89-1 | |
301.2 | |
C14H18Cl2N2O |
> 98% (HPLC) | |
711085-63-1 |
99.64% | |
711085-63-1 | |
264.75 | |
C14H17ClN2O |
99.35% | |
737727-12-7 | |
264.75 | |
C14H17ClN2O |
98.00% | |
128311-08-0 | |
301.21 | |
C14H18Cl2N2O |