You have no items in your shopping cart.
Cart summary
Phellodendrine chloride
Catalog Number: orb1301322
| Catalog Number | orb1301322 |
|---|---|
| Category | Small Molecules |
| Description | Phellodendrine chloride |
| CAS Number | 104112-82-5 |
| Purity | 99.05% |
| MW | 377.86 |
| SMILES | [Cl-].COc1cc2C[N+]3(C)CCc4cc(OC)c(O)cc4[C@@H]3Cc2cc1O |
| Formula | C20H24ClNO4 |
| Biological Activity | Phellodendrine chloride has anti-nephritic activity, may be due to its ability to inhibit the proliferation or the migration of macrophages and cytotoxic T lymphocytes in the glomeruli. |
| Storage | -20°C |
| Note | For research use only |
| Expiration Date | 12 months from date of receipt. |
