You have no items in your shopping cart.
You have no items in your shopping cart.
Catalog Number | orb1302743 |
---|---|
Category | Small Molecules |
Description | Perospirone |
Purity | 99.45% |
MW | 426.57 |
Biological Activity | Perospirone (Lullan) is an antagonist of serotonin 5HT2A receptors and dopamine D2 receptors. It also displays affinity towards 5HT1A receptors as a partial agonist. |
CAS Number | [150915-41-6] |
Formula | C23H30N4O2S |
SMILES | [H][C@@]12CCCC[C@]1([H])C(=O)N(CCCCN1CCN(CC1)c1nsc3ccccc13)C2=O |
Storage | -20°C |
Note | For research use only |
> 98% (HPLC) | |
150915-41-6 | |
426.6 | |
C23H30N4O2S |
99.37% | |
[129273-38-7] | |
463 | |
C23H31ClN4O2S |