You have no items in your shopping cart.
Cart summary
Niclosamide sodium
Catalog Number: orb1744854
| Catalog Number | orb1744854 |
|---|---|
| Category | Small Molecules |
| Description | Niclosamide sodium (BAY2353), an orally active antihelminthic agent employed in parasitic infection research, serves as a potent STAT3 inhibitor, demonstrating an IC50 of 0.25 μM in HeLa cells. Additionally, this compound exhibits significant biological activities against cancer and effectively inhibits DNA replication in Vero E6 cells. |
| CAS Number | 40321-86-6 |
| Purity | 98.00% |
| MW | 349.1 |
| SMILES | O=[N+]([O-])C1=CC(Cl)=C(NC(C2=C([O-])C=CC(Cl)=C2)=O)C=C1.[Na+] |
| Formula | C13H7Cl2N2NaO4 |
| Biological Activity | Niclosamide sodium (BAY2353), an orally active antihelminthic agent employed in parasitic infection research, serves as a potent STAT3 inhibitor, demonstrating an IC50 of 0.25 μM in HeLa cells. Additionally, this compound exhibits significant biological activities against cancer and effectively inhibits DNA replication in Vero E6 cells. |
| Storage | -20°C |
| Note | For research use only |
| Expiration Date | 12 months from date of receipt. |
