You have no items in your shopping cart.
You have no items in your shopping cart.
Catalog Number | orb654566 |
---|---|
Category | Small Molecules |
Description | Lipid 5 is an amino lipid that affords efficient mRNA delivery in rodent and primate models. Lipid 5 shows optimal pharmacokinetics and non-toxic side effects.Replacement of the linoleic tail with a primary ester-containing lipid tail (Lipid 5) provids increased expression and optimal tissue clearance. The metabolite identification studies with Lipid 5 indicated that hydrolysis of the primary ester is the first step in the metabolism of the lipid[1].Clearance of Lipid 5 and MC3 from multiple mouse tissues is measured after dosing 0.05 mg/kg mRNA on days 1, 8, and 15 in CD-1 female mice. Liver and spleen have the highest levels of Lipid 5, however, significantly lower levels than MC3. Lipid 5 is detected in plasma, lung, and kidney, but not in heart[1]. |
CAS Number | [2089251-33-0] |
MW | 710.165 |
SMILES | O=C(CCCCCCCN(CCCCCCCC(=O)OCCCCCCCCC)CCO)OC(CCCCCCCC)CCCCCCCC |
Formula | C44H87NO5 |
Note | For research use only |
Expiration Date | 12 months from date of receipt. |
Chemical structure of orb654566
ICC, IF, IHC-Fr, IHC-P, WB | |
Bovine, Canine, Equine, Gallus, Guinea pig, Porcine | |
Human, Mouse, Rat | |
Rabbit | |
Polyclonal | |
Unconjugated |
FC, ICC, IF, IHC-Fr, IHC-P | |
Gallus | |
Human, Rat | |
Rabbit | |
Polyclonal | |
Unconjugated |
ICC, IF, IHC-Fr, IHC-P, WB | |
Mouse, Rat | |
Human, Mouse, Rat | |
Rabbit | |
Recombinant | |
Unconjugated |
WB | |
Porcine | |
Mouse, Rat | |
Rabbit | |
Polyclonal | |
Unconjugated |
IF, IHC-Fr, IHC-P | |
Bovine, Canine, Equine, Human | |
Mouse, Rat | |
Rabbit | |
Polyclonal | |
Unconjugated |