You have no items in your shopping cart.
You have no items in your shopping cart.
Catalog Number | orb1301303 |
---|---|
Category | Small Molecules |
Description | Liensinine |
CAS Number | 2586-96-1 |
Purity | 99.56% |
MW | 610.74 |
SMILES | COc1cc2CCN(C)[C@H](Cc3ccc(O)c(Oc4cc5[C@@H](Cc6ccc(O)cc6)N(C)CCc5cc4OC)c3)c2cc1OC |
Formula | C37H42N2O6 |
Biological Activity | 1. Liensinine, a kind of isoquinoline alkaloid, can antagonize the ventricular arrhythmias. |
Storage | -20°C |
Note | For research use only |
Expiration Date | 12 months from date of receipt. |
98.99% | |
2385-63-9 | |
711.2 | |
C37H43ClN2O10 |
99.80% | |
5088-90-4 | |
811.67 | |
C37H44Cl2N2O14 |