You have no items in your shopping cart.
You have no items in your shopping cart.
Catalog Number | orb180754 |
---|---|
Category | Small Molecules |
Description | Lapatinib Ditosylate (GW572016, GW2016, Tykerb, Tyverb) is a potent EGFR and ErbB2 inhibitor with IC50 of 10.8 and 9.2 nM, respectively. |
CAS Number | [388082-78-8] |
MW | 943.4761 |
SMILES | ClC1=C(C([H])=C([H])C(=C1[H])N([H])C1C2=C(C([H])=C([H])C(=C2[H])C2=C([H])C([H])=C(C([H])([H])N([H])C([H])([H])C([H])([H])S(C([H])([H])[H])(=O)=O)O2)N=C([H])N=1)OC([H])([H])C1C([H])=C([H])C([H])=C(C=1[H])F |
Formula | C43N4O11FS3CLH44 |
Note | For research use only |
Expiration Date | 12 months from date of receipt. |
≥99% | |
388082-78-8 | |
925.46 | |
C26H26ClFN4O4S 2C7H8O3S H2O |
99.71% | |
388082-77-7 | |
925.46 | |
C43H42ClFN4O10S3 |
99% | |
388082-78-8 | |
943.47 | |
C43H44ClFN4O11S3 |
> =98% | |
388082-77-7 | |
925.46 | |
C29H26ClFN4O4S.2C7H8O3S |
> 98% (HPLC) | |
388082-77-7 | |
925.5 | |
C43H42ClFN4O10S3 |