You have no items in your shopping cart.
You have no items in your shopping cart.
Catalog Number | orb2645891 |
---|---|
Category | Small Molecules |
Description | (KFF)3K is a cell-penetrating peptide that enhances the absorption of other antibiotics by disrupting the outer membrane of bacteria. This compound introduces a hydrocarbon scaffold that induces its antibacterial properties, rendering it an effective antimicrobial peptide. Additionally, (KFF)3K has potential applications in the development of novel antimicrobial agents. |
Purity | 98.00% |
MW | 1412.76 |
CAS Number | 622402-94-2 |
Formula | C78H105N15O10 |
SMILES | [C@H](CC1=CC=CC=C1)(C(N[C@@H](CC2=CC=CC=C2)C(N[C@H](C(N[C@@H](CC3=CC=CC=C3)C(N[C@@H](CC4=CC=CC=C4)C(N[C@@H](CCCCN)C(N)=O)=O)=O)=O)CCCCN)=O)=O)NC([C@@H](NC([C@H](CC5=CC=CC=C5)NC([C@H](CC6=CC=CC=C6)NC([C@H](CCCCN)N)=O)=O)=O)CCCCN)=O |
Storage | -20°C |
Note | For research use only |