You have no items in your shopping cart.
Cart summary
IMR-1
Catalog Number: orb1300399
| Catalog Number | orb1300399 |
|---|---|
| Category | Small Molecules |
| Description | IMR-1 |
| Purity | 98.08% |
| MW | 353.41 |
| Biological Activity | IMR-1 is a novel class of Notch inhibitors targeting the transcriptional activation with IC50 of 6 μMol/L. |
| CAS Number | [310456-65-6] |
| Formula | C15H15NO5S2 |
| SMILES | CCOC(=O)COc1ccc(\C=C2\SC(=S)NC2=O)cc1OC |
| Storage | -20°C |
| Note | For research use only |
