You have no items in your shopping cart.
You have no items in your shopping cart.
Catalog Number | orb572932 |
---|---|
Category | Small Molecules |
Description | H-Val-Pro-Pro-OH (TFA) is a trifluoroacetate (TFA) salt form of the tripeptide H-Val-Pro-Pro-OH, which is derived from milk proteins. This peptide is known for its ability to inhibit Angiotensin I Converting Enzyme (ACE), a key enzyme in the renin-angiotensin system (RAS) that regulates blood pressure. The TFA salt form is commonly used in research and pharmaceutical applications to improve the solubility and stability of the peptide. |
MW | 425.400055408478 |
CAS Number | [2828433-08-3] |
Formula | C17H26F3N3O6 |
SMILES | C(F)(F)(F)C(=O)O.C(N1CCC[C@H]1C(=O)O)([C@@H]1CCCN1C(=O)[C@@H](N)C(C)C)=O |
Note | For research use only |
98.00% | |
425.4 | |
C17H26F3N3O6 |