You have no items in your shopping cart.
You have no items in your shopping cart.
Catalog Number | orb1305100 |
---|---|
Category | Small Molecules |
Description | Gossypol (acetic acid) |
Purity | 98.57% |
MW | 578.61 |
Biological Activity | Gossypol acetic acid (AT101), a polyphenolic compound isolated from cottonseeds, binds with Bcl-2, Bcl-xL, Mcl-1, and does not inhibit BIR3 domain and BID. |
CAS Number | [12542-36-8] |
Formula | C32H34O10 |
SMILES | CC(O)=O.CC(C)c1c(O)c(O)c(C=O)c2c(O)c(c(C)cc12)-c1c(C)cc2c(C(C)C)c(O)c(O)c(C=O)c2c1O |
Storage | -20°C |
Note | For research use only |
98.00% | |
[1189561-66-7] | |
578.61 | |
C32H34O10 |
96.73% | |
[866541-93-7] | |
578.61 | |
C30H30O8·C2H4O2 |