You have no items in your shopping cart.
You have no items in your shopping cart.
Catalog Number | orb1300850 |
---|---|
Category | Small Molecules |
Description | Geldanamycin |
Purity | 99.27% |
MW | 560.64 |
Biological Activity | Geldanamycin, an HSP90 inhibitor (Kd: 1.2 μM), specifically disrupts glucocorticoid receptor (GR)/HSP association. |
CAS Number | [30562-34-6] |
Formula | C29H40N2O9 |
SMILES | [H][C@@]1(C)CC2=C(OC)C(=O)C=C(NC(=O)\C(C)=C/C=C\[C@]([H])(OC)[C@]([H])(OC(N)=O)\C(C)=C/[C@@]([H])(C)C(O)[C@@]([H])(C1)OC)C2=O |
Storage | -20°C |
Note | For research use only |
> 98%(HPLC) | |
30562-34-6 | |
560.6 | |
C29H40N2O9 |
98.00% | |
1146534-45-3 | |
681.27 | |
C34H53ClN4O8 |