You have no items in your shopping cart.
Cart summary
gamma-Mangostin
Catalog Number: orb1302309
| Catalog Number | orb1302309 |
|---|---|
| Category | Small Molecules |
| Description | gamma-Mangostin |
| CAS Number | 31271-07-5 |
| Purity | 99.08% |
| MW | 396.43 |
| SMILES | CC(C)=CCc1c(O)cc2oc3cc(O)c(O)c(CC=C(C)C)c3c(=O)c2c1O |
| Formula | C23H24O6 |
| Biological Activity | 1. gamma-Mangostin (Normangostin) as a preventive agent of the metabolic syndrome. 2. Gamma-Mangostin has free radical scavenging activity, and antiproliferative and apoptotic activity in HepG2 cells. 3. Gamma-Mangostin could serve as a micronutrient for colon cancer prevention and is a potential lead compound for the development of anti-colon cancer agents. 4. Gamma-Mangostin may acts as an antihypertensive agent , by causing vasorelaxation which is mediated via the NO-cGMP pathway. |
| Storage | -20°C |
| Note | For research use only |
| Expiration Date | 12 months from date of receipt. |
