You have no items in your shopping cart.
You have no items in your shopping cart.
Catalog Number | orb1302309 |
---|---|
Category | Small Molecules |
Description | gamma-Mangostin |
Purity | 99.08% |
MW | 396.43 |
Biological Activity | 1. gamma-Mangostin (Normangostin) as a preventive agent of the metabolic syndrome. 2. Gamma-Mangostin has free radical scavenging activity, and antiproliferative and apoptotic activity in HepG2 cells. 3. Gamma-Mangostin could serve as a micronutrient for colon cancer prevention and is a potential lead compound for the development of anti-colon cancer agents. 4. Gamma-Mangostin may acts as an antihypertensive agent , by causing vasorelaxation which is mediated via the NO-cGMP pathway. |
CAS Number | [31271-07-5] |
Formula | C23H24O6 |
SMILES | CC(C)=CCc1c(O)cc2oc3cc(O)c(O)c(CC=C(C)C)c3c(=O)c2c1O |
Storage | -20°C |
Note | For research use only |
> 98% (HPLC) | |
31271-07-5 | |
396.4 | |
C23H24O6 |