You have no items in your shopping cart.
Cart summary
Forsythoside B
Catalog Number: orb401879
| Catalog Number | orb401879 |
|---|---|
| Category | Small Molecules |
| Description | Forsythoside B is a phenylethanoid glycoside isolated from the leaves of Lamiophlomis rotata Kudo, a Chinese folk medicinal plant for treating inflammatory diseases and promoting blood circulation. |
| CAS Number | [81525-13-5] |
| MW | 756.7 |
| SMILES | OC1=C(O)C=C(/C=C/C(O[C@H]2[C@H](O[C@]3([H])O[C@@H](C)[C@H](O)[C@@H](O)[C@H]3O)[C@@H](O)[C@H](OCCC4=CC=C(O)C(O)=C4)O[C@@H]2CO[C@H]5[C@H](O)[C@](CO)(O)CO5)=O)C=C1 |
| Formula | C34H44O19 |
| Note | For research use only |
| Expiration Date | 12 months from date of receipt. |
Forsythoside B [orb1303598]
98.78%
81525-13-5
756.7
C34H44O19
1 ml x 10 mm (in DMSO), 50 mg, 100 mg, 10 mg, 5 mg, 25 mg, 1 mg
