You have no items in your shopping cart.
You have no items in your shopping cart.
Catalog Number | orb1737799 |
---|---|
Category | Small Molecules |
Description | FFA3-Agonist-1 |
Purity | 98.00% |
MW | 362.42 |
Biological Activity | FFA3 Agonist 1, a potent agonist of the free fatty acid receptor 3 (FFA3), plays a crucial role in mediating the health-promoting effects of the intestinal microbiota through the activation of FFA3. |
CAS Number | 886358-51-6 |
Formula | C22H22N2O3 |
SMILES | C(NC1=C(C)C=CC=C1)(=O)C=2C(C3=C(NC2C)CCCC3=O)C4=CC=CO4 |
Storage | -20°C |
Note | For research use only |