You have no items in your shopping cart.
Cart summary
(±)-Emodin bianthrone
Catalog Number: orb2277483
| Catalog Number | orb2277483 |
|---|---|
| Category | Small Molecules |
| Description | (±)-Emodin bianthrone (compound 10), a naturally occurring substance, demonstrates antimalarial, antitubercular, and antifungal properties [1]. |
| Purity | 98.00% |
| MW | 510.49 |
| Biological Activity | (±)-Emodin bianthrone (compound 10), a naturally occurring substance, demonstrates antimalarial, antitubercular, and antifungal properties [1]. |
| CAS Number | 61281-20-7 |
| Formula | C30H22O8 |
| SMILES | O=C1C=2C([C@@](C=3C1=C(O)C=C(O)C3)([C@]4(C=5C(C(=O)C=6C4=CC(O)=CC6O)=C(O)C=C(C)C5)[H])[H])=CC(C)=CC2O |
| Storage | -20°C |
| Note | For research use only |
