You have no items in your shopping cart.
You have no items in your shopping cart.
Catalog Number | orb533047 |
---|---|
Category | Small Molecules |
Description | dTTP, PCR-grade is supplied as ultrapure aqueous solution (pH 8.5) and suitable for all molecular biology applications including PCR/qPCR, reverse transcription, DNA labeling and DNA sequencing. |
Form/Appearance | clear aqueous solution; pH: 8.5 ± 0.2 (22 °C) |
Concentration | 100 mM-110 mM |
Purity | ≥ 99% (HPLC) |
MW | Theoretical MW: 482.17 g/mol (free acid) |
Application notes | < b>Spectroscopic Propertie: λmax 267 nm, ε 9.5 L mmol-1 cm-1 (Tris-HCl, pH 7.0). |
CAS Number | 18423-43-3 |
Formula | C10H17N2O14P3 |
SMILES | Cc1cn(c(=O)[nH]c1=O)[C@@H]1O[C@H](COP(=O)(O)OP(=O)(O)OP(=O)(O)O)[C@@H](O)C1 |
Storage | store at -20 °C |
Note | For research use only |
≥ 99% (HPLC) | |
18423-43-3 | |
Theoretical MW: 482.17 g/mol (free acid) | |
C10H17N2O14P3 |