You have no items in your shopping cart.
You have no items in your shopping cart.
Catalog Number | orb1296974 |
---|---|
Category | Small Molecules |
Description | Dihydroarteannuin B |
Purity | 98.18% |
MW | 250.33 |
Biological Activity | Dihydroarteannuin B ((3R)-dihydroarteannuin B) is a natural Dihydroarteannuin. |
CAS Number | [87206-33-5] |
Formula | C15H22O3 |
SMILES | C[C@]12[C@]([C@@]34[C@]([C@@H](C)C(=O)O3)(CC[C@@H](C)[C@@]4(CC1)[H])[H])(O2)[H] |
Storage | -20°C |
Note | For research use only |
> 98% (HPLC) | |
87206-33-5 | |
250.3 | |
C15H22O3 |