You have no items in your shopping cart.
Cart summary
Decamethonium bromide
Catalog Number: orb1310265
| Catalog Number | orb1310265 |
|---|---|
| Category | Small Molecules |
| Description | Decamethonium bromide |
| Purity | 99.79% |
| MW | 418.29 |
| Biological Activity | Decamethonium bromide (Syncurine) is a neuromuscular blocker and nicotinic AChR partial agonist. |
| CAS Number | 541-22-0 |
| Formula | C16H38Br2N2 |
| SMILES | [Br-].[Br-].C[N+](C)(C)CCCCCCCCCC[N+](C)(C)C |
| Storage | -20°C |
| Note | For research use only |
