You have no items in your shopping cart.
Cart summary
Dayecrystal A
Catalog Number: orb2299450
| Catalog Number | orb2299450 |
|---|---|
| Category | Small Molecules |
| Description | Dayecrystal A is a natural product and can be used as a standard reference. |
| CAS Number | 926010-24-4 |
| Purity | 98.00% |
| MW | 320.5 |
| SMILES | C(=O)[C@]12[C@]3([C@]4(C(O)[C@@](CC3)([C@@](C)(O)C4)[H])CC[C@@]1(C(C)(C)CCC2)[H])[H] |
| Formula | C20H32O3 |
| Biological Activity | Dayecrystal A is a natural product and can be used as a standard reference. |
| Storage | -20°C |
| Note | For research use only |
| Expiration Date | 12 months from date of receipt. |
