You have no items in your shopping cart.
You have no items in your shopping cart.
Catalog Number | orb611916 |
---|---|
Category | Small Molecules |
Description | Daunorubicin is potent topoisomerase II (Topo II) inhibitor, interacts with DNA by intercalation and inhibition of macromolecular biosynthesis in cancer cells. |
MW | 527.526 |
CAS Number | [20830-81-3] |
Formula | C27H29NO10 |
SMILES | O=C(C(C(OC)=CC=C1)=C1C2=O)C3=C2C(O)=C(C[C@@](O)(C(C)=O)C[C@@H]4O[C@@]5([H])C[C@H](N)[C@H](O)[C@H](C)O5)C4=C3O |
Note | For research use only |
> 98% (HPLC) | |
23541-50-6 | |
564 | |
C27H30ClNO10 |
> 98% (HPLC) | |
20830-81-3 | |
527.5 | |
C27H29NO10 |
99.53% | |
[23541-50-6] | |
563.99 | |
C27H29NO10·HCl |