You have no items in your shopping cart.
Cart summary
CI-39
Catalog Number: orb1982869
| Catalog Number | orb1982869 |
|---|---|
| Category | Small Molecules |
| Description | CI-39, a natural antiviral product, serves as a non-nucleoside reverse transcriptase inhibitor (NNRTI) targeting wild type HIV-1. It exhibits an effective concentration (EC50) of 3.40 µM against the virus, while its cytotoxic concentration (CC50) exceeds 30 µM. This compound notably impedes HIV-1 reverse transcriptase (RT) DNA polymerase and ribonuclease H activities[1]. |
| CAS Number | 2132412-25-8 |
| Purity | 98.00% |
| MW | 338.36 |
| SMILES | COC(=O)c1ccccc1NC(=O)Cc1cn(OC)c2ccccc12 |
| Formula | C19H18N2O4 |
| Biological Activity | CI-39, a natural antiviral product, serves as a non-nucleoside reverse transcriptase inhibitor (NNRTI) targeting wild type HIV-1. It exhibits an effective concentration (EC50) of 3.40 µM against the virus, while its cytotoxic concentration (CC50) exceeds 30 µM. This compound notably impedes HIV-1 reverse transcriptase (RT) DNA polymerase and ribonuclease H activities[1]. |
| Storage | -20°C |
| Note | For research use only |
| Expiration Date | 12 months from date of receipt. |
