You have no items in your shopping cart.
Cart summary
Catalponol methylthiomethyl ether
Catalog Number: orb1684093
| Catalog Number | orb1684093 |
|---|---|
| Category | Small Molecules |
| Description | Catalponol methylthiomethyl ether |
| CAS Number | 1432057-74-3 |
| Purity | 98% |
| MW | 290.42 |
| SMILES | CC(C)=CC[C@H](C[C@@H](c1c2cccc1)OCSC)C2=O |
| Formula | C17H22O2S |
| Biological Activity | Catalponol methylthiomethyl ether is a natural product from plants |
| Storage | -20°C |
| Note | For research use only |
| Expiration Date | 12 months from date of receipt. |
