You have no items in your shopping cart.
You have no items in your shopping cart.
Catalog Number | orb105092 |
---|---|
Category | Small Molecules |
Description | Capsaicin |
CAS Number | [2444-46-4] |
MW | 293.4 |
SMILES | OC1=C(OC)C=C(CNC(CCCCCCCC)=O)C=C1 |
Formula | C17H27NO3 |
Note | For research use only |
Expiration Date | 12 months from date of receipt. |
IF, IHC-Fr, IHC-P, WB | |
Bovine, Canine, Equine, Human, Porcine, Rabbit, Rat, Sheep | |
Mouse | |
Rabbit | |
Polyclonal | |
Unconjugated |
IF, IHC-Fr, IHC-P, WB | |
Bovine, Canine, Equine, Human, Porcine, Rabbit, Rat, Sheep | |
Mouse | |
Rabbit | |
Polyclonal | |
Unconjugated |
IHC-P, WB | |
Human, Mouse, Rat | |
Rabbit | |
Polyclonal | |
Unconjugated |