You have no items in your shopping cart.
You have no items in your shopping cart.
Catalog Number | orb611544 |
---|---|
Category | Small Molecules |
Description | Biperiden (KL 373) is a centrally-acting antiparkinsonian agent that functions as a selective central M1 cholinoreceptors blocker.. |
MW | 311.46106 |
CAS Number | [514-65-8] |
Formula | C21H29NO |
SMILES | OC([C@H]1C[C@@H]2C=C[C@H]1C2)(CCN3CCCCC3)C4=CC=CC=C4 |
Note | For research use only |
99.65% | |
514-65-8 | |
311.46 | |
C21H29NO |