You have no items in your shopping cart.
Cart summary
Austocystin B
Catalog Number: orb2279469
| Catalog Number | orb2279469 |
|---|---|
| Category | Small Molecules |
| Description | Austocystin B is a natural product that can be used as a reference standard. The CAS number of Austocystin B is 55256-57-0. |
| CAS Number | 55256-57-0 |
| Purity | 98.00% |
| MW | 396.395 |
| SMILES | CC(C)(O)CCc1ccc(O)c2c1oc1cc3OC4OC=CC4c3c(O)c1c2=O |
| Formula | C22H20O7 |
| Storage | -20°C |
| Note | For research use only |
| Expiration Date | 12 months from date of receipt. |
