You have no items in your shopping cart.
Cart summary
ATWLPPR Peptide TFA
Catalog Number: orb573314
| Catalog Number | orb573314 |
|---|---|
| Category | Small Molecules |
| Description | ATWLPPR Peptide TFA, a heptapeptide, acts as a selective neuropilin-1 inhibitor, inhibits VEGF165 binding to NRP-1, used in the research of angiogenesis. ATWLPPR Peptide TFA has potential in reducing the early retinal damage caused by diabetes. |
| MW | 954 |
| Formula | C42H62F3N11O11 |
| SMILES | O=C(N[C@@H]([C@H](O)C)C(N[C@@H](CC1=CNC2=CC=CC=C12)C(N[C@@H](CC(C)C)C(N3[C@@H](CCC3)C(N4[C@@H](CCC4)C(N[C@@H](CCCNC(N)=N)C(O)=O)=O)=O)=O)=O)=O)[C@H](C)N.OC(C(F)(F)F)=O |
| Note | For research use only |
