You have no items in your shopping cart.
Cart summary
anemarsaponin B
Catalog Number: orb1300130
| Catalog Number | orb1300130 |
|---|---|
| Category | Small Molecules |
| Description | anemarsaponin B |
| CAS Number | 139051-27-7 |
| Purity | 99.06% |
| MW | 903.06 |
| SMILES | CC12C(C3C(CC1)C4(C)C(CC3)CC(OC5C(OC6OC(CO)C(O)C(O)C6O)C(O)C(O)C(CO)O5)CC4)CC7C2C(C)=C(CCC(COC8OC(CO)C(O)C(O)C8O)C)O7 |
| Formula | C45H74O18 |
| Biological Activity | Anemarsaponin B has anti-inflammatory effect in LPS-treated RAW 264.7macrophages, the effect is associated with the inhibition of NF-κB transcriptional activity, possibly via the p38 MAP kinase pathway. Anemarsaponin B can inhibit PAF-induced rabbit platelet aggregation in vitro. |
| Storage | -20°C |
| Note | For research use only |
| Expiration Date | 12 months from date of receipt. |
