You have no items in your shopping cart.
Cart summary
All-trans-Phytofluene
Catalog Number: orb2563979
| Catalog Number | orb2563979 |
|---|---|
| Category | Small Molecules |
| Description | All-trans-Phytofluene (Phytofluene), a compound extractable from tomatoes, plays a crucial role in the isomerization of lycopene and phytoene within the same fruit. |
| CAS Number | 540-05-6 |
| Purity | 98.00% |
| MW | 542.92 |
| SMILES | C(=C/CC/C(=C/C=C/C=C(/C=C/C=C(/CC/C=C(/CCC=C(C)C)\C)\C)\C)/C)(\CC/C=C(/CCC=C(C)C)\C)/C |
| Formula | C40H62 |
| Storage | -20°C |
| Note | For research use only |
| Expiration Date | 12 months from date of receipt. |
