You have no items in your shopping cart.
You have no items in your shopping cart.
Catalog Number | orb1986985 |
---|---|
Category | Small Molecules |
Description | A-10255 is a complex of thiopeptide antibiotics from Streptomyces gardneri. |
Purity | 98.00% |
MW | 953.98 |
Biological Activity | A-10255 is a complex of thiopeptide antibiotics from Streptomyces gardneri. |
CAS Number | 144376-84-1 |
Formula | C40H35N13O10S3 |
SMILES | C\C=C1/NC(=O)C(NC(=O)c2csc(n2)-c2ccc(nc2-c2coc(n2)C(=C)NC(=O)C(=C)NC(=O)c2cnc(s2)C(C)NC(=O)c2cnc(CNC(=O)c3cnc1o3)s2)C(N)=O)C(C)O |
Storage | -20°C |
Note | For research use only |