You have no items in your shopping cart.
Cart summary
4-IPP (4-Iodo-6-phenylpyrimidine)
Catalog Number: orb692023
| Catalog Number | orb692023 |
|---|---|
| Category | Small Molecules |
| Description | 4-IPP (4-Iodo-6-phenylpyrimidine) is a specific suicide substrate and irreversible inhibitor of macrophage migration inhibitory factor (MIF). |
| CAS Number | [41270-96-6] |
| MW | 282.08 |
| SMILES | IC1N=CN=C(C2C=CC=CC=2)C=1 |
| Formula | C10H7IN2 |
| Note | For research use only |
| Expiration Date | 12 months from date of receipt. |
