You have no items in your shopping cart.
Cart summary
4-Hydroxyphenylpropionylglycine
Catalog Number: orb1980127
| Catalog Number | orb1980127 |
|---|---|
| Category | Small Molecules |
| Description | 4-Hydroxyphenylpropionylglycine, a metabolite derived from the conditionally essential amino acid tyrosine, is synthesized through a process involving aromatic amino acid aminotransferase and tyrosine aminotransferase activities, with subsequent modifications by gut microbiota and glycine conjugation. Additionally, it serves as a metabolite of the phenol phloretin. |
| CAS Number | 3850-43-9 |
| Purity | 98.00% |
| MW | 223.23 |
| SMILES | O=C(CNC(CCC1=CC=C(C=C1)O)=O)O |
| Formula | C11H13NO4 |
| Biological Activity | 4-Hydroxyphenylpropionylglycine, a metabolite derived from the conditionally essential amino acid tyrosine, is synthesized through a process involving aromatic amino acid aminotransferase and tyrosine aminotransferase activities, with subsequent modifications by gut microbiota and glycine conjugation. Additionally, it serves as a metabolite of the phenol phloretin. |
| Storage | -20°C |
| Note | For research use only |
| Expiration Date | 12 months from date of receipt. |
