You have no items in your shopping cart.
You have no items in your shopping cart.
Catalog Number | orb1300235 |
---|---|
Category | Small Molecules |
Description | 2"-O-Galloylhyperin |
Purity | 99.12% |
MW | 616.48 |
Biological Activity | 2"-O-Galloylhyperin (FT-0689359) found in Pyrola. It increases ruminal fiber fermentability by formed wall-bound lignin in primary maize cell walls. |
CAS Number | [53209-27-1] |
Formula | C28H24O16 |
SMILES | OC[C@@H]1O[C@H](Oc2c(oc3cc(O)cc(O)c3c2=O)-c2ccc(O)c(O)c2)[C@@H](OC(=O)c2cc(O)c(O)c(O)c2)[C@H](O)[C@@H]1O |
Storage | -20°C |
Note | For research use only |
FC, IF, IHC-Fr, IHC-P, WB | |
Bovine, Canine, Porcine | |
Human, Mouse, Rat | |
Rabbit | |
Polyclonal | |
Unconjugated |
FC, ICC, IF, IHC-Fr, IHC-P, WB | |
Mouse, Rat | |
Human, Mouse, Rat | |
Rabbit | |
Recombinant | |
Unconjugated |
ELISA, FC, ICC, IF, IHC, WB | |
Human, Mouse, Rat | |
Rabbit | |
Polyclonal | |
Unconjugated |
FC, IF, IHC-Fr, IHC-P, WB | |
Rat | |
Human, Mouse, Rat | |
Rabbit | |
Polyclonal | |
Unconjugated |
FC, IF, IHC-Fr, IHC-P | |
Mouse, Rat | |
Human, Mouse, Rat | |
Mouse | |
Monoclonal | |
Unconjugated |