You have no items in your shopping cart.
Cart summary
2-Methoxycinnamic acid
Catalog Number: orb1304679
| Catalog Number | orb1304679 |
|---|---|
| Category | Small Molecules |
| Description | 2-Methoxycinnamic acid |
| CAS Number | 6099-03-2 |
| Purity | 99.68% |
| MW | 178.18 |
| SMILES | C(=CC(O)=O)C1=C(OC)C=CC=C1 |
| Formula | C10H10O3 |
| Biological Activity | 1. 2-Methoxycinnamic acid (o-Methoxycinnamic acid) can enhance inhibition of tyrosinase activity. |
| Storage | -20°C |
| Note | For research use only |
| Expiration Date | 12 months from date of receipt. |
