You have no items in your shopping cart.
Cart summary
2-Bromo-6-methoxynaphthalene
Catalog Number: orb1310407
| Catalog Number | orb1310407 |
|---|---|
| Category | Small Molecules |
| Description | 2-Bromo-6-methoxynaphthalene |
| Purity | 98.80% |
| MW | 237.09 |
| Biological Activity | 2-Bromo-6-methoxynaphthalene was used in the synthesis of nabumetone [4-(6-methoxy-2-naphthalenyl)-2-butanone] by Heck reaction. |
| CAS Number | 5111-65-9 |
| Formula | C11H9BrO |
| SMILES | COC1=CC=C2C=C(Br)C=CC2=C1 |
| Storage | -20°C |
| Note | For research use only |
