You have no items in your shopping cart.
Cart summary
16-O-Acetylpolyporenic acid C
Catalog Number: orb2299453
| Catalog Number | orb2299453 |
|---|---|
| Category | Small Molecules |
| Description | 16-O-Acetylpolyporenic acid C is a natural product and can be used as a standard reference. |
| CAS Number | 2535-06-0 |
| Purity | 98.00% |
| MW | 524.7 |
| SMILES | C[C@]12[C@@](C)([C@@]([C@@H](CCC(C(C)C)=C)C(O)=O)([C@H](OC(C)=O)C1)[H])CC=C3C2=CC[C@@]4([C@]3(C)CCC(=O)C4(C)C)[H] |
| Formula | C33H48O5 |
| Biological Activity | 16-O-Acetylpolyporenic acid C is a natural product and can be used as a standard reference. |
| Storage | -20°C |
| Note | For research use only |
| Expiration Date | 12 months from date of receipt. |
