You have no items in your shopping cart.
Cart summary
Glycerol phenylbutyrate
Catalog Number: orb1308269
| Catalog Number | orb1308269 |
|---|---|
| Category | Small Molecules |
| Description | Glycerol phenylbutyrate |
| Purity | 99.00% |
| MW | 530.65 |
| Biological Activity | Glycerol phenylbutyrate (HPN-100) (GPB) is a new generation ammonia scavenger drug and it also is a sigma-2 (σ2) receptor ligand (pKi: 8.02). |
| CAS Number | [611168-24-2] |
| Formula | C33H38O6 |
| SMILES | O=C(CCCc1ccccc1)OCC(COC(=O)CCCc1ccccc1)OC(=O)CCCc1ccccc1 |
| Storage | -20°C |
| Note | For research use only |
