You have no items in your shopping cart.
You have no items in your shopping cart.
Catalog Number | orb422378 |
---|---|
Category | Small Molecules |
Description | Fluticasone is a synthetic glucocorticoid which is used in some countries to treat nasal symptoms. |
MW | 444.507596254349 |
CAS Number | [90566-53-3] |
Formula | C22H27F3O4S |
SMILES | C[C@@]12[C@@](O)(C(=O)SCF)[C@H](C)C[C@H]1[C@@H]1C[C@H](F)C3=CC(C=C[C@]3(C)[C@]1([C@H](C2)O)F)=O |
Note | For research use only |
> 98%(HPLC) | |
80474-14-2 | |
500.6 | |
C25H31F3O5S |
98.00% | |
28416-82-2 | |
396.42 | |
C21H26F2O5 |