You have no items in your shopping cart.
Cart summary
Emoxypine Succinate
Catalog Number: orb1299424
| Catalog Number | orb1299424 |
|---|---|
| Category | Small Molecules |
| Description | Emoxypine Succinate |
| CAS Number | 127464-43-1 |
| Purity | 98% |
| MW | 255.27 |
| SMILES | OC(=O)CCC(O)=O.CCc1nc(C)ccc1O |
| Formula | C12H17NO5 |
| Biological Activity | Emoxypine Succinate is an antioxidant. |
| Storage | -20°C |
| Note | For research use only |
| Expiration Date | 12 months from date of receipt. |
