You have no items in your shopping cart.
Cart summary
Diphenylcyclopropenone
Catalog Number: orb1306359
| Catalog Number | orb1306359 |
|---|---|
| Category | Small Molecules |
| Description | Diphenylcyclopropenone |
| CAS Number | 886-38-4 |
| Purity | 99.90% |
| MW | 206.24 |
| SMILES | O=C1C(=C1C1=CC=CC=C1)C1=CC=CC=C1 |
| Formula | C15H10O |
| Biological Activity | Diphenylcyclopropenone (DPCP) is a topical drug used to treat alopecia areata, alopecia totalis, and refractory warts. Diphencyprone acts as a local stimulator that triggers an immune response against the action of autoreactive cells. |
| Storage | -20°C |
| Note | For research use only |
| Expiration Date | 12 months from date of receipt. |
