You have no items in your shopping cart.
You have no items in your shopping cart.
Catalog Number | orb1309888 |
---|---|
Category | Small Molecules |
Description | Baclofen |
Purity | 99.85% |
MW | 213.66 |
Biological Activity | Baclofen (Lioresal) is a synthetic chlorophenyl-butanoic acid derivative used to treat spasms due to spinal cord damage and multiple sclerosis, muscle-relaxing Baclofen acts as a gamma-aminobutyric acid (GABA) agonist specific for GABA-B receptors. It acts at spinal and supraspinal sites, reducing excitatory transmission. |
CAS Number | [1134-47-0] |
Formula | C10H12ClNO2 |
SMILES | NCC(CC(O)=O)C1=CC=C(Cl)C=C1 |
Storage | -20°C |
Note | For research use only |
> 98% (HPLC) | |
69308-37-8 | |
213.7 | |
C10H12ClNO2 |
99.55% | |
28311-31-1 | |
250.122 | |
C10H13Cl2NO2 |